C11H12BrF3N2O3 — CID 103350810
N-[(3-bromo-5-nitrophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 103350810) has the molecular formula C11H12BrF3N2O3 and a molecular weight of 357.13 g/mol. Its IUPAC name is N-[(3-bromo-5-nitrophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(3-bromo-5-nitrophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103350810 |
| Molecular Formula | C11H12BrF3N2O3 |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | N-[(3-bromo-5-nitrophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | O=[N+]([O-])c1cc(Br)cc(CNCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12BrF3N2O3/c12-9-3-8(4-10(5-9)17(18)19)6-16-1-2-20-7-11(13,14)15/h3-5,16H,1-2,6-7H2 |
| InChIKey | HBSZAMOQWVCPEU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|