C12H15BrF3NO3 — CID 60733268
2-bromo-6-methoxy-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]phenol (PubChem CID 60733268) has the molecular formula C12H15BrF3NO3 and a molecular weight of 358.15 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 60733268 |
| Molecular Formula | C12H15BrF3NO3 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2-bromo-6-methoxy-4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]phenol |
| SMILES | COc1cc(CNCCOCC(F)(F)F)cc(Br)c1O |
| InChI | InChI=1S/C12H15BrF3NO3/c1-19-10-5-8(4-9(13)11(10)18)6-17-2-3-20-7-12(14,15)16/h4-5,17-18H,2-3,6-7H2,1H3 |
| InChIKey | DRZUSGAKFLUWKC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|