C12H15F4NO2 — CID 103529436
N-[(3,5-dimethoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529436) has the molecular formula C12H15F4NO2 and a molecular weight of 281.25 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529436 |
| Molecular Formula | C12H15F4NO2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | COc1cc(CNCC(F)(F)C(F)F)cc(OC)c1 |
| InChI | InChI=1S/C12H15F4NO2/c1-18-9-3-8(4-10(5-9)19-2)6-17-7-12(15,16)11(13)14/h3-5,11,17H,6-7H2,1-2H3 |
| InChIKey | SPUQTRNOHFESJH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|