C11H14F4N2O — CID 103529375
2,2,3,3-tetrafluoro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]propan-1-amine (PubChem CID 103529375) has the molecular formula C11H14F4N2O and a molecular weight of 266.24 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103529375 |
| Molecular Formula | C11H14F4N2O |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]propan-1-amine |
| SMILES | COc1cc(C)nc(CNCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H14F4N2O/c1-7-3-9(18-2)4-8(17-7)5-16-6-11(14,15)10(12)13/h3-4,10,16H,5-6H2,1-2H3 |
| InChIKey | GDBFJMNXXVDBIP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|