C13H16BrF4NO2 — CID 103529678
N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529678) has the molecular formula C13H16BrF4NO2 and a molecular weight of 374.17 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529678 |
| Molecular Formula | C13H16BrF4NO2 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCOc1c(Br)cc(CNCC(F)(F)C(F)F)cc1OC |
| InChI | InChI=1S/C13H16BrF4NO2/c1-3-21-11-9(14)4-8(5-10(11)20-2)6-19-7-13(17,18)12(15)16/h4-5,12,19H,3,6-7H2,1-2H3 |
| InChIKey | AFIZIZMALCELDU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|