C17H18BrClFNO2 — CID 60615929
N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(3-chloro-4-fluorophenyl)methanamine (PubChem CID 60615929) has the molecular formula C17H18BrClFNO2 and a molecular weight of 402.69 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(3-chloro-4-fluorophenyl)methanamine.
| Compound Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(3-chloro-4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 60615929 |
| Molecular Formula | C17H18BrClFNO2 |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(3-chloro-4-fluorophenyl)methanamine |
| SMILES | CCOc1c(Br)cc(CNCc2ccc(F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C17H18BrClFNO2/c1-3-23-17-13(18)6-12(8-16(17)22-2)10-21-9-11-4-5-15(20)14(19)7-11/h4-8,21H,3,9-10H2,1-2H3 |
| InChIKey | TWVRCABGOJZYIW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |