C21H20OS2 — CID 102387106
1-[1,1-bis(phenylsulfanyl)ethyl]-4-methoxybenzene (PubChem CID 102387106) has the molecular formula C21H20OS2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[1,1-bis(phenylsulfanyl)ethyl]-4-methoxybenzene.
| Compound Name | 1-[1,1-bis(phenylsulfanyl)ethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 102387106 |
| Molecular Formula | C21H20OS2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[1,1-bis(phenylsulfanyl)ethyl]-4-methoxybenzene |
| SMILES | COc1ccc(C(C)(Sc2ccccc2)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20OS2/c1-21(23-19-9-5-3-6-10-19,24-20-11-7-4-8-12-20)17-13-15-18(22-2)16-14-17/h3-16H,1-2H3 |
| InChIKey | YVFCEZNPBISZOZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|