C17H14BrF3OS — CID 101381812
1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-methoxybenzene (PubChem CID 101381812) has the molecular formula C17H14BrF3OS and a molecular weight of 403.26 g/mol. Its IUPAC name is 1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-methoxybenzene.
| Compound Name | 1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101381812 |
| Molecular Formula | C17H14BrF3OS |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-methoxybenzene |
| SMILES | COc1ccc(/C(=C(\CBr)Sc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14BrF3OS/c1-22-13-9-7-12(8-10-13)16(17(19,20)21)15(11-18)23-14-5-3-2-4-6-14/h2-10H,11H2,1H3/b16-15- |
| InChIKey | MDIDYLWDAPUXIH-NXVVXOECSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|