C17H11BrF6S — CID 101381807
1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-(trifluoromethyl)benzene (PubChem CID 101381807) has the molecular formula C17H11BrF6S and a molecular weight of 441.23 g/mol. Its IUPAC name is 1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 101381807 |
| Molecular Formula | C17H11BrF6S |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 1-[(Z)-4-bromo-1,1,1-trifluoro-3-phenylsulfanylbut-2-en-2-yl]-4-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)/C(=C(/CBr)Sc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11BrF6S/c18-10-14(25-13-4-2-1-3-5-13)15(17(22,23)24)11-6-8-12(9-7-11)16(19,20)21/h1-9H,10H2/b15-14- |
| InChIKey | LARSDLQFPRMUHW-PFONDFGASA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|