C23H19F3OS2 — CID 10048442
(1R)-4,4-bis(phenylsulfanyl)-1-[4-(trifluoromethyl)phenyl]but-3-en-1-ol (PubChem CID 10048442) has the molecular formula C23H19F3OS2 and a molecular weight of 432.53 g/mol. Its IUPAC name is (1R)-4,4-bis(phenylsulfanyl)-1-[4-(trifluoromethyl)phenyl]but-3-en-1-ol.
| Compound Name | (1R)-4,4-bis(phenylsulfanyl)-1-[4-(trifluoromethyl)phenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 10048442 |
| Molecular Formula | C23H19F3OS2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (1R)-4,4-bis(phenylsulfanyl)-1-[4-(trifluoromethyl)phenyl]but-3-en-1-ol |
| SMILES | O[C@H](CC=C(Sc1ccccc1)Sc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F3OS2/c24-23(25,26)18-13-11-17(12-14-18)21(27)15-16-22(28-19-7-3-1-4-8-19)29-20-9-5-2-6-10-20/h1-14,16,21,27H,15H2/t21-/m1/s1 |
| InChIKey | ISQJBVBTKNCMSL-OAQYLSRUSA-N |
| XLogP | 7.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |