C18H16BrF3O2 — CID 10949406
1-[(E)-1-bromo-4,4,4-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]-4-methoxybenzene (PubChem CID 10949406) has the molecular formula C18H16BrF3O2 and a molecular weight of 401.22 g/mol. Its IUPAC name is 1-[(E)-1-bromo-4,4,4-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]-4-methoxybenzene.
| Compound Name | 1-[(E)-1-bromo-4,4,4-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 10949406 |
| Molecular Formula | C18H16BrF3O2 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1-[(E)-1-bromo-4,4,4-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]-4-methoxybenzene |
| SMILES | COc1ccc(/C(CBr)=C(/c2ccc(OC)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16BrF3O2/c1-23-14-7-3-12(4-8-14)16(11-19)17(18(20,21)22)13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3/b17-16- |
| InChIKey | MOQYFZSPPDTFMP-MSUUIHNZSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|