C14H13F5O — CID 11358288
1-methoxy-4-[(2E,4E)-1,1,1,3,6-pentafluorohepta-2,4-dien-2-yl]benzene (PubChem CID 11358288) has the molecular formula C14H13F5O and a molecular weight of 292.25 g/mol. Its IUPAC name is 1-methoxy-4-[(2E,4E)-1,1,1,3,6-pentafluorohepta-2,4-dien-2-yl]benzene.
| Compound Name | 1-methoxy-4-[(2E,4E)-1,1,1,3,6-pentafluorohepta-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 11358288 |
| Molecular Formula | C14H13F5O |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-methoxy-4-[(2E,4E)-1,1,1,3,6-pentafluorohepta-2,4-dien-2-yl]benzene |
| SMILES | COc1ccc(/C(=C(F)/C=C/C(C)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F5O/c1-9(15)3-8-12(16)13(14(17,18)19)10-4-6-11(20-2)7-5-10/h3-9H,1-2H3/b8-3+,13-12+ |
| InChIKey | FJMMFSWGKLZYNV-PJGOPNSOSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|