C18H15F3O3S — CID 101242043
[(Z)-2-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)ethenyl] 2,2,2-trifluoroacetate (PubChem CID 101242043) has the molecular formula C18H15F3O3S and a molecular weight of 368.38 g/mol. Its IUPAC name is [(Z)-2-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)ethenyl] 2,2,2-trifluoroacetate.
| Compound Name | [(Z)-2-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)ethenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 101242043 |
| Molecular Formula | C18H15F3O3S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [(Z)-2-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)ethenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(/C=C(\OC(=O)C(F)(F)F)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C18H15F3O3S/c1-23-14-7-3-12(4-8-14)11-16(24-17(22)18(19,20)21)13-5-9-15(25-2)10-6-13/h3-11H,1-2H3/b16-11- |
| InChIKey | JBWCHDLHQLFUFO-WJDWOHSUSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|