C19H15F3O4 — CID 126370205
(2Z)-4,4,4-trifluoro-1-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylidene]butane-1,3-dione (PubChem CID 126370205) has the molecular formula C19H15F3O4 and a molecular weight of 364.32 g/mol. Its IUPAC name is (2Z)-4,4,4-trifluoro-1-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylidene]butane-1,3-dione.
| Compound Name | (2Z)-4,4,4-trifluoro-1-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylidene]butane-1,3-dione |
|---|---|
| PubChem CID | 126370205 |
| Molecular Formula | C19H15F3O4 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (2Z)-4,4,4-trifluoro-1-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylidene]butane-1,3-dione |
| SMILES | COc1ccc(/C=C(/C(=O)c2ccc(OC)cc2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3O4/c1-25-14-7-3-12(4-8-14)11-16(18(24)19(20,21)22)17(23)13-5-9-15(26-2)10-6-13/h3-11H,1-2H3/b16-11- |
| InChIKey | XLQOKHLIIWUGFC-WJDWOHSUSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|