C17H24O2 — CID 143176753
ethane;(E,2Z)-2-ethylidene-1-(4-methoxyphenyl)-3-methylpent-3-en-1-one (PubChem CID 143176753) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is ethane;(E,2Z)-2-ethylidene-1-(4-methoxyphenyl)-3-methylpent-3-en-1-one.
| Compound Name | ethane;(E,2Z)-2-ethylidene-1-(4-methoxyphenyl)-3-methylpent-3-en-1-one |
|---|---|
| PubChem CID | 143176753 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | ethane;(E,2Z)-2-ethylidene-1-(4-methoxyphenyl)-3-methylpent-3-en-1-one |
| SMILES | C/C=C(C(=O)c1ccc(OC)cc1)/C(C)=C/C.CC |
| InChI | InChI=1S/C15H18O2.C2H6/c1-5-11(3)14(6-2)15(16)12-7-9-13(17-4)10-8-12;1-2/h5-10H,1-4H3;1-2H3/b11-5+,14-6-; |
| InChIKey | DZTLLTQOJBRVPR-CQHMZMFASA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|