C25H19F3O4 — CID 46242474
1,3-bis(4-methoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]propane-1,3-dione (PubChem CID 46242474) has the molecular formula C25H19F3O4 and a molecular weight of 440.42 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]propane-1,3-dione.
| Compound Name | 1,3-bis(4-methoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]propane-1,3-dione |
|---|---|
| PubChem CID | 46242474 |
| Molecular Formula | C25H19F3O4 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]propane-1,3-dione |
| SMILES | COc1ccc(C(=O)C(=Cc2ccc(C(F)(F)F)cc2)C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H19F3O4/c1-31-20-11-5-17(6-12-20)23(29)22(24(30)18-7-13-21(32-2)14-8-18)15-16-3-9-19(10-4-16)25(26,27)28/h3-15H,1-2H3 |
| InChIKey | YXVVKANWQCZUKS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|