C17H14F2O3 — CID 5186455
2,3-difluoro-1,3-bis(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 5186455) has the molecular formula C17H14F2O3 and a molecular weight of 304.29 g/mol. Its IUPAC name is 2,3-difluoro-1,3-bis(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 2,3-difluoro-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5186455 |
| Molecular Formula | C17H14F2O3 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2,3-difluoro-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C(F)=C(F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H14F2O3/c1-21-13-7-3-11(4-8-13)15(18)16(19)17(20)12-5-9-14(22-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | FMVCKZBROXJYRJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|