C19H14F4O3 — CID 6037096
(1E,4E)-1,2,4,5-tetrafluoro-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 6037096) has the molecular formula C19H14F4O3 and a molecular weight of 366.31 g/mol. Its IUPAC name is (1E,4E)-1,2,4,5-tetrafluoro-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,2,4,5-tetrafluoro-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 6037096 |
| Molecular Formula | C19H14F4O3 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (1E,4E)-1,2,4,5-tetrafluoro-1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C(F)=C(\F)C(=O)/C(F)=C(\F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H14F4O3/c1-25-13-7-3-11(4-8-13)15(20)17(22)19(24)18(23)16(21)12-5-9-14(26-2)10-6-12/h3-10H,1-2H3/b17-15+,18-16+ |
| InChIKey | SUOGPBRNNYMAHY-YTEMWHBBSA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|