C12H16F2OSi — CID 11322461
[(Z)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-trimethylsilane (PubChem CID 11322461) has the molecular formula C12H16F2OSi and a molecular weight of 242.34 g/mol. Its IUPAC name is [(Z)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-trimethylsilane.
| Compound Name | [(Z)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11322461 |
| Molecular Formula | C12H16F2OSi |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [(Z)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-trimethylsilane |
| SMILES | COc1ccc(/C(F)=C(\F)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C12H16F2OSi/c1-15-10-7-5-9(6-8-10)11(13)12(14)16(2,3)4/h5-8H,1-4H3/b12-11- |
| InChIKey | NIWNETYNFFJXHH-QXMHVHEDSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|