C10H10F2O — CID 169086546
1-(3,3-difluoroprop-1-en-2-yl)-4-methoxybenzene (PubChem CID 169086546) has the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. Its IUPAC name is 1-(3,3-difluoroprop-1-en-2-yl)-4-methoxybenzene.
| Compound Name | 1-(3,3-difluoroprop-1-en-2-yl)-4-methoxybenzene |
|---|---|
| PubChem CID | 169086546 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(3,3-difluoroprop-1-en-2-yl)-4-methoxybenzene |
| SMILES | C=C(c1ccc(OC)cc1)C(F)F |
| InChI | InChI=1S/C10H10F2O/c1-7(10(11)12)8-3-5-9(13-2)6-4-8/h3-6,10H,1H2,2H3 |
| InChIKey | IEMWWXONHKKQCG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |