C13H12F2O4 — CID 102175200
ethyl (Z)-2,3-difluoro-4-(4-methoxyphenyl)-4-oxobut-2-enoate (PubChem CID 102175200) has the molecular formula C13H12F2O4 and a molecular weight of 270.23 g/mol. Its IUPAC name is ethyl (Z)-2,3-difluoro-4-(4-methoxyphenyl)-4-oxobut-2-enoate.
| Compound Name | ethyl (Z)-2,3-difluoro-4-(4-methoxyphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 102175200 |
| Molecular Formula | C13H12F2O4 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | ethyl (Z)-2,3-difluoro-4-(4-methoxyphenyl)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(/F)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H12F2O4/c1-3-19-13(17)11(15)10(14)12(16)8-4-6-9(18-2)7-5-8/h4-7H,3H2,1-2H3/b11-10- |
| InChIKey | PFGXZLHGLBYOGQ-KHPPLWFESA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|