C16H16O4S2 — CID 23727172
ethyl (2E)-3-(4-methoxyphenyl)-2-(4-methyl-1,3-dithiol-2-ylidene)-3-oxopropanoate (PubChem CID 23727172) has the molecular formula C16H16O4S2 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl (2E)-3-(4-methoxyphenyl)-2-(4-methyl-1,3-dithiol-2-ylidene)-3-oxopropanoate.
| Compound Name | ethyl (2E)-3-(4-methoxyphenyl)-2-(4-methyl-1,3-dithiol-2-ylidene)-3-oxopropanoate |
|---|---|
| PubChem CID | 23727172 |
| Molecular Formula | C16H16O4S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | ethyl (2E)-3-(4-methoxyphenyl)-2-(4-methyl-1,3-dithiol-2-ylidene)-3-oxopropanoate |
| SMILES | CCOC(=O)/C(C(=O)c1ccc(OC)cc1)=C1\SC=C(C)S1 |
| InChI | InChI=1S/C16H16O4S2/c1-4-20-15(18)13(16-21-9-10(2)22-16)14(17)11-5-7-12(19-3)8-6-11/h5-9H,4H2,1-3H3/b16-13+ |
| InChIKey | UJSROHGQXHCDPF-DTQAZKPQSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|