C24H36B2O7 — CID 154711690
ethyl (E)-3-(4-methoxyphenyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate (PubChem CID 154711690) has the molecular formula C24H36B2O7 and a molecular weight of 458.17 g/mol. Its IUPAC name is ethyl (E)-3-(4-methoxyphenyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4-methoxyphenyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 154711690 |
| Molecular Formula | C24H36B2O7 |
| Molecular Weight | 458.17 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | ethyl (E)-3-(4-methoxyphenyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(B1OC(C)(C)C(C)(C)O1)=C(\B1OC(C)(C)C(C)(C)O1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H36B2O7/c1-11-29-20(27)19(26-32-23(6,7)24(8,9)33-26)18(16-12-14-17(28-10)15-13-16)25-30-21(2,3)22(4,5)31-25/h12-15H,11H2,1-10H3/b19-18+ |
| InChIKey | HCFQLQAEFRDFAU-VHEBQXMUSA-N |
| XLogP | 4.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|