C19H25BF2O4 — CID 138976356
ethyl (Z)-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate (PubChem CID 138976356) has the molecular formula C19H25BF2O4 and a molecular weight of 366.21 g/mol. Its IUPAC name is ethyl (Z)-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate.
| Compound Name | ethyl (Z)-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate |
|---|---|
| PubChem CID | 138976356 |
| Molecular Formula | C19H25BF2O4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl (Z)-2,2-difluoro-3-methyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate |
| SMILES | CCOC(=O)C(F)(F)/C(C)=C(/B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C19H25BF2O4/c1-7-24-16(23)19(21,22)13(2)15(14-11-9-8-10-12-14)20-25-17(3,4)18(5,6)26-20/h8-12H,7H2,1-6H3/b15-13+ |
| InChIKey | PGZZSXYUCNZTEQ-FYWRMAATSA-N |
| XLogP | 4.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|