C17H22BF4NO2 — CID 171112305
1,1,1,5-tetrafluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine (PubChem CID 171112305) has the molecular formula C17H22BF4NO2 and a molecular weight of 359.17 g/mol. Its IUPAC name is 1,1,1,5-tetrafluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine.
| Compound Name | 1,1,1,5-tetrafluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 171112305 |
| Molecular Formula | C17H22BF4NO2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1,1,1,5-tetrafluoro-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
| SMILES | CC1(C)OB(C(F)=C(CC(N)C(F)(F)F)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C17H22BF4NO2/c1-15(2)16(3,4)25-18(24-15)14(19)12(10-13(23)17(20,21)22)11-8-6-5-7-9-11/h5-9,13H,10,23H2,1-4H3 |
| InChIKey | CMSMBHQWXMGRIY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|