C20H29BFNO3 — CID 171112563
1-[3-fluoro-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidin-4-ol (PubChem CID 171112563) has the molecular formula C20H29BFNO3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 1-[3-fluoro-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidin-4-ol.
| Compound Name | 1-[3-fluoro-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 171112563 |
| Molecular Formula | C20H29BFNO3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[3-fluoro-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]piperidin-4-ol |
| SMILES | CC1(C)OB(C(F)=C(CN2CCC(O)CC2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C20H29BFNO3/c1-19(2)20(3,4)26-21(25-19)18(22)17(15-8-6-5-7-9-15)14-23-12-10-16(24)11-13-23/h5-9,16,24H,10-14H2,1-4H3 |
| InChIKey | UYEQHRAGHOVDNP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|