C21H31BClFO2 — CID 171112038
2-[2-(4-tert-butylphenyl)-5-chloro-1-fluoropent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171112038) has the molecular formula C21H31BClFO2 and a molecular weight of 380.74 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-5-chloro-1-fluoropent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(4-tert-butylphenyl)-5-chloro-1-fluoropent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171112038 |
| Molecular Formula | C21H31BClFO2 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-5-chloro-1-fluoropent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)c1ccc(C(CCCCl)=C(F)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H31BClFO2/c1-19(2,3)16-12-10-15(11-13-16)17(9-8-14-23)18(24)22-25-20(4,5)21(6,7)26-22/h10-13H,8-9,14H2,1-7H3 |
| InChIKey | WIUYZBHBLNZXAZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|