C18H24BF4NO2 — CID 171112325
1,1,1,5-tetrafluoro-4-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine (PubChem CID 171112325) has the molecular formula C18H24BF4NO2 and a molecular weight of 373.20 g/mol. Its IUPAC name is 1,1,1,5-tetrafluoro-4-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine.
| Compound Name | 1,1,1,5-tetrafluoro-4-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 171112325 |
| Molecular Formula | C18H24BF4NO2 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1,1,1,5-tetrafluoro-4-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
| SMILES | Cc1ccc(C(CC(N)C(F)(F)F)=C(F)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H24BF4NO2/c1-11-6-8-12(9-7-11)13(10-14(24)18(21,22)23)15(20)19-25-16(2,3)17(4,5)26-19/h6-9,14H,10,24H2,1-5H3 |
| InChIKey | OUFSTRVTIFOFCD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|