C20H28BFO4 — CID 171114615
5-fluoro-4-(4-propan-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoic acid (PubChem CID 171114615) has the molecular formula C20H28BFO4 and a molecular weight of 362.25 g/mol. Its IUPAC name is 5-fluoro-4-(4-propan-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoic acid.
| Compound Name | 5-fluoro-4-(4-propan-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoic acid |
|---|---|
| PubChem CID | 171114615 |
| Molecular Formula | C20H28BFO4 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 5-fluoro-4-(4-propan-2-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoic acid |
| SMILES | CC(C)c1ccc(C(CCC(=O)O)=C(F)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H28BFO4/c1-13(2)14-7-9-15(10-8-14)16(11-12-17(23)24)18(22)21-25-19(3,4)20(5,6)26-21/h7-10,13H,11-12H2,1-6H3,(H,23,24) |
| InChIKey | CCTPPMQDNSEQJM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|