C15H18O4 — CID 94770615
(2E)-2-[(4-propan-2-ylphenyl)methylidene]pentanedioic acid (PubChem CID 94770615) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2E)-2-[(4-propan-2-ylphenyl)methylidene]pentanedioic acid.
| Compound Name | (2E)-2-[(4-propan-2-ylphenyl)methylidene]pentanedioic acid |
|---|---|
| PubChem CID | 94770615 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2E)-2-[(4-propan-2-ylphenyl)methylidene]pentanedioic acid |
| SMILES | CC(C)c1ccc(/C=C(\CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H18O4/c1-10(2)12-5-3-11(4-6-12)9-13(15(18)19)7-8-14(16)17/h3-6,9-10H,7-8H2,1-2H3,(H,16,17)(H,18,19)/b13-9+ |
| InChIKey | OIGTVNYIKFZCJW-UKTHLTGXSA-N |
| XLogP | 3.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|