C12H11ClO4 — CID 82159773
(2E)-2-[(4-chlorophenyl)methylidene]pentanedioic acid (PubChem CID 82159773) has the molecular formula C12H11ClO4 and a molecular weight of 254.67 g/mol. Its IUPAC name is (2E)-2-[(4-chlorophenyl)methylidene]pentanedioic acid.
| Compound Name | (2E)-2-[(4-chlorophenyl)methylidene]pentanedioic acid |
|---|---|
| PubChem CID | 82159773 |
| Molecular Formula | C12H11ClO4 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (2E)-2-[(4-chlorophenyl)methylidene]pentanedioic acid |
| SMILES | O=C(O)CC/C(=C\c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C12H11ClO4/c13-10-4-1-8(2-5-10)7-9(12(16)17)3-6-11(14)15/h1-2,4-5,7H,3,6H2,(H,14,15)(H,16,17)/b9-7+ |
| InChIKey | PPYAUZFQQGBSKF-VQHVLOKHSA-N |
| XLogP | 2.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|