C20H28BF4NO3 — CID 171112327
1,1,1,5-tetrafluoro-4-(4-propoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine (PubChem CID 171112327) has the molecular formula C20H28BF4NO3 and a molecular weight of 417.25 g/mol. Its IUPAC name is 1,1,1,5-tetrafluoro-4-(4-propoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine.
| Compound Name | 1,1,1,5-tetrafluoro-4-(4-propoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 171112327 |
| Molecular Formula | C20H28BF4NO3 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1,1,1,5-tetrafluoro-4-(4-propoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-amine |
| SMILES | CCCOc1ccc(C(CC(N)C(F)(F)F)=C(F)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H28BF4NO3/c1-6-11-27-14-9-7-13(8-10-14)15(12-16(26)20(23,24)25)17(22)21-28-18(2,3)19(4,5)29-21/h7-10,16H,6,11-12,26H2,1-5H3 |
| InChIKey | FAPVELKVQIIKEU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|