C15H23BFNO3 — CID 168920234
(1R)-3-(4-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine (PubChem CID 168920234) has the molecular formula C15H23BFNO3 and a molecular weight of 295.16 g/mol. Its IUPAC name is (1R)-3-(4-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine.
| Compound Name | (1R)-3-(4-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 168920234 |
| Molecular Formula | C15H23BFNO3 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (1R)-3-(4-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine |
| SMILES | CC1(C)OB([C@@H](N)CCOc2ccc(F)cc2)OC1(C)C |
| InChI | InChI=1S/C15H23BFNO3/c1-14(2)15(3,4)21-16(20-14)13(18)9-10-19-12-7-5-11(17)6-8-12/h5-8,13H,9-10,18H2,1-4H3/t13-/m0/s1 |
| InChIKey | FJXYMPLBZIKYQM-ZDUSSCGKSA-N |
| XLogP | 2.55 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|