C17H29BClNO3 — CID 168920113
(1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride (PubChem CID 168920113) has the molecular formula C17H29BClNO3 and a molecular weight of 341.69 g/mol. Its IUPAC name is (1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 168920113 |
| Molecular Formula | C17H29BClNO3 |
| Molecular Weight | 341.69 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine;hydrochloride |
| SMILES | COc1ccc(CCC[C@H](N)B2OC(C)(C)C(C)(C)O2)cc1.Cl |
| InChI | InChI=1S/C17H28BNO3.ClH/c1-16(2)17(3,4)22-18(21-16)15(19)8-6-7-13-9-11-14(20-5)12-10-13;/h9-12,15H,6-8,19H2,1-5H3;1H/t15-;/m0./s1 |
| InChIKey | DHSKEJZSLVFSIX-RSAXXLAASA-N |
| XLogP | 3.40 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|