C14H22BNO3 — CID 171191324
(S)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171191324) has the molecular formula C14H22BNO3 and a molecular weight of 263.15 g/mol. Its IUPAC name is (S)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (S)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171191324 |
| Molecular Formula | C14H22BNO3 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (S)-(4-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | COc1ccc([C@@H](N)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C14H22BNO3/c1-13(2)14(3,4)19-15(18-13)12(16)10-6-8-11(17-5)9-7-10/h6-9,12H,16H2,1-5H3/t12-/m1/s1 |
| InChIKey | ICKVHQRKQWZJPR-GFCCVEGCSA-N |
| XLogP | 2.33 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|