C16H26BNO5 — CID 171191327
(S)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-(2,4,6-trimethoxyphenyl)methanamine (PubChem CID 171191327) has the molecular formula C16H26BNO5 and a molecular weight of 323.20 g/mol. Its IUPAC name is (S)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-(2,4,6-trimethoxyphenyl)methanamine.
| Compound Name | (S)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-(2,4,6-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 171191327 |
| Molecular Formula | C16H26BNO5 |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (S)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-(2,4,6-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)c([C@@H](N)B2OC(C)(C)C(C)(C)O2)c(OC)c1 |
| InChI | InChI=1S/C16H26BNO5/c1-15(2)16(3,4)23-17(22-15)14(18)13-11(20-6)8-10(19-5)9-12(13)21-7/h8-9,14H,18H2,1-7H3/t14-/m1/s1 |
| InChIKey | BEQIOOGQWQFOIV-CQSZACIVSA-N |
| XLogP | 2.34 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|