C14H21BBrNO3 — CID 171191390
(S)-(4-bromo-2-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171191390) has the molecular formula C14H21BBrNO3 and a molecular weight of 342.04 g/mol. Its IUPAC name is (S)-(4-bromo-2-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (S)-(4-bromo-2-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171191390 |
| Molecular Formula | C14H21BBrNO3 |
| Molecular Weight | 342.04 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (S)-(4-bromo-2-methoxyphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | COc1cc(Br)ccc1[C@@H](N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H21BBrNO3/c1-13(2)14(3,4)20-15(19-13)12(17)10-7-6-9(16)8-11(10)18-5/h6-8,12H,17H2,1-5H3/t12-/m1/s1 |
| InChIKey | CUMZTBZAHUCGJZ-GFCCVEGCSA-N |
| XLogP | 3.09 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.04 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|