C15H24BNO5 — CID 171191350
4-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3,5-dimethoxyphenol (PubChem CID 171191350) has the molecular formula C15H24BNO5 and a molecular weight of 309.17 g/mol. Its IUPAC name is 4-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3,5-dimethoxyphenol.
| Compound Name | 4-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171191350 |
| Molecular Formula | C15H24BNO5 |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 4-[(S)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)cc(OC)c1[C@@H](N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H24BNO5/c1-14(2)15(3,4)22-16(21-14)13(17)12-10(19-5)7-9(18)8-11(12)20-6/h7-8,13,18H,17H2,1-6H3/t13-/m1/s1 |
| InChIKey | WNCMPMRBVNXQEE-CYBMUJFWSA-N |
| XLogP | 2.04 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|