C10H16ClNO3 — CID 171221934
4-[(1S)-1-aminoethyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171221934) has the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-aminoethyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171221934 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)cc(OC)c1[C@H](C)N.Cl |
| InChI | InChI=1S/C10H15NO3.ClH/c1-6(11)10-8(13-2)4-7(12)5-9(10)14-3;/h4-6,12H,11H2,1-3H3;1H/t6-;/m0./s1 |
| InChIKey | QWZYJGJNHNCFHF-RGMNGODLSA-N |
| XLogP | 1.85 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |