C10H14ClNO2 — CID 130139712
1-(4-chloro-2,6-dimethoxyphenyl)ethanamine (PubChem CID 130139712) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 1-(4-chloro-2,6-dimethoxyphenyl)ethanamine.
| Compound Name | 1-(4-chloro-2,6-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 130139712 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(4-chloro-2,6-dimethoxyphenyl)ethanamine |
| SMILES | COc1cc(Cl)cc(OC)c1C(C)N |
| InChI | InChI=1S/C10H14ClNO2/c1-6(12)10-8(13-2)4-7(11)5-9(10)14-3/h4-6H,12H2,1-3H3 |
| InChIKey | OLZYUTSJGMQESE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |