C10H14BrNO2 — CID 82759020
(1R)-1-(2-bromo-4,6-dimethoxyphenyl)ethanamine (PubChem CID 82759020) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is (1R)-1-(2-bromo-4,6-dimethoxyphenyl)ethanamine.
| Compound Name | (1R)-1-(2-bromo-4,6-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 82759020 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (1R)-1-(2-bromo-4,6-dimethoxyphenyl)ethanamine |
| SMILES | COc1cc(Br)c([C@@H](C)N)c(OC)c1 |
| InChI | InChI=1S/C10H14BrNO2/c1-6(12)10-8(11)4-7(13-2)5-9(10)14-3/h4-6H,12H2,1-3H3/t6-/m1/s1 |
| InChIKey | DKWXXAAJQXXOEY-ZCFIWIBFSA-N |
| XLogP | 2.49 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |