C13H21NO3 — CID 116914648
N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)ethanamine (PubChem CID 116914648) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)ethanamine.
| Compound Name | N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 116914648 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc(OC)c(C(C)N(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H21NO3/c1-9(14(2)3)13-11(16-5)7-10(15-4)8-12(13)17-6/h7-9H,1-6H3 |
| InChIKey | HXBKQZMFEMPSRI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |