C24H34BBrO8 — CID 159386589
2-bromo-1,3,5-trimethoxybenzene;4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane (PubChem CID 159386589) has the molecular formula C24H34BBrO8 and a molecular weight of 541.24 g/mol. Its IUPAC name is 2-bromo-1,3,5-trimethoxybenzene;4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane.
| Compound Name | 2-bromo-1,3,5-trimethoxybenzene;4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159386589 |
| Molecular Formula | C24H34BBrO8 |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 2-bromo-1,3,5-trimethoxybenzene;4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane |
| SMILES | COc1cc(OC)c(B2OC(C)(C)C(C)(C)O2)c(OC)c1.COc1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C15H23BO5.C9H11BrO3/c1-14(2)15(3,4)21-16(20-14)13-11(18-6)8-10(17-5)9-12(13)19-7;1-11-6-4-7(12-2)9(10)8(5-6)13-3/h8-9H,1-7H3;4-5H,1-3H3 |
| InChIKey | LLOOFBOHYNUSIC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|