C14H20BBrO4 — CID 138987118
2-(3-bromo-2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 138987118) has the molecular formula C14H20BBrO4 and a molecular weight of 343.03 g/mol. Its IUPAC name is 2-(3-bromo-2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-bromo-2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 138987118 |
| Molecular Formula | C14H20BBrO4 |
| Molecular Weight | 343.03 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(3-bromo-2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc(Br)c(OC)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H20BBrO4/c1-13(2)14(3,4)20-15(19-13)11-10(17-5)8-7-9(16)12(11)18-6/h7-8H,1-6H3 |
| InChIKey | HQAGPTALWGIIKC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.03 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|