C22H38B2O5Si — CID 102407946
[3-methoxy-2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-dimethylsilane (PubChem CID 102407946) has the molecular formula C22H38B2O5Si and a molecular weight of 432.25 g/mol. Its IUPAC name is [3-methoxy-2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-dimethylsilane.
| Compound Name | [3-methoxy-2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-dimethylsilane |
|---|---|
| PubChem CID | 102407946 |
| Molecular Formula | C22H38B2O5Si |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | [3-methoxy-2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-dimethylsilane |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)c(C[SiH](C)C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H38B2O5Si/c1-19(2)20(3,4)27-23(26-19)16-12-13-17(25-9)18(15(16)14-30(10)11)24-28-21(5,6)22(7,8)29-24/h12-13,30H,14H2,1-11H3 |
| InChIKey | FAGJOYCUHNKPLK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|