C24H30BBrO8 — CID 157298277
2-bromo-4,6-dimethoxybenzaldehyde;2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 157298277) has the molecular formula C24H30BBrO8 and a molecular weight of 537.21 g/mol. Its IUPAC name is 2-bromo-4,6-dimethoxybenzaldehyde;2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 2-bromo-4,6-dimethoxybenzaldehyde;2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 157298277 |
| Molecular Formula | C24H30BBrO8 |
| Molecular Weight | 537.21 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 2-bromo-4,6-dimethoxybenzaldehyde;2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | COc1cc(Br)c(C=O)c(OC)c1.COc1cc(OC)c(C=O)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H21BO5.C9H9BrO3/c1-14(2)15(3,4)21-16(20-14)12-7-10(18-5)8-13(19-6)11(12)9-17;1-12-6-3-8(10)7(5-11)9(4-6)13-2/h7-9H,1-6H3;3-5H,1-2H3 |
| InChIKey | BBPBIEHDUFHZGG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|