C15H22BFO4 — CID 164893130
2-(3-ethoxy-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164893130) has the molecular formula C15H22BFO4 and a molecular weight of 296.15 g/mol. Its IUPAC name is 2-(3-ethoxy-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-ethoxy-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164893130 |
| Molecular Formula | C15H22BFO4 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(3-ethoxy-2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOc1cc(OC)cc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C15H22BFO4/c1-7-19-12-9-10(18-6)8-11(13(12)17)16-20-14(2,3)15(4,5)21-16/h8-9H,7H2,1-6H3 |
| InChIKey | GUXDGOWXDKYWMJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|