C14H19BF2O3 — CID 156807681
2-(4-ethoxy-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 156807681) has the molecular formula C14H19BF2O3 and a molecular weight of 284.11 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-ethoxy-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 156807681 |
| Molecular Formula | C14H19BF2O3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-(4-ethoxy-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1F |
| InChI | InChI=1S/C14H19BF2O3/c1-6-18-10-8-7-9(11(16)12(10)17)15-19-13(2,3)14(4,5)20-15/h7-8H,6H2,1-5H3 |
| InChIKey | PRPUSFQOUTWHQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|