C17H18BF2NO3 — CID 156778711
2-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine (PubChem CID 156778711) has the molecular formula C17H18BF2NO3 and a molecular weight of 333.14 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine.
| Compound Name | 2-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine |
|---|---|
| PubChem CID | 156778711 |
| Molecular Formula | C17H18BF2NO3 |
| Molecular Weight | 333.14 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine |
| SMILES | CC1(C)OB(c2ccc(Oc3ccccn3)c(F)c2F)OC1(C)C |
| InChI | InChI=1S/C17H18BF2NO3/c1-16(2)17(3,4)24-18(23-16)11-8-9-12(15(20)14(11)19)22-13-7-5-6-10-21-13/h5-10H,1-4H3 |
| InChIKey | YFJTWEIDSLMUBR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.14 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|