C23H21BF3NO2 — CID 122389334
2-[3,4,5-trifluoro-2-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 122389334) has the molecular formula C23H21BF3NO2 and a molecular weight of 411.23 g/mol. Its IUPAC name is 2-[3,4,5-trifluoro-2-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2-[3,4,5-trifluoro-2-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 122389334 |
| Molecular Formula | C23H21BF3NO2 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[3,4,5-trifluoro-2-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2c(F)c(F)c(F)c(-c3ccccc3)c2-c2ccccn2)OC1(C)C |
| InChI | InChI=1S/C23H21BF3NO2/c1-22(2)23(3,4)30-24(29-22)18-17(15-12-8-9-13-28-15)16(14-10-6-5-7-11-14)19(25)21(27)20(18)26/h5-13H,1-4H3 |
| InChIKey | JRPSPRYWRFJBQJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|